About 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane
6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane (PubChem CID 142406263) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane |
| PubChem CID | 142406263 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane |
| SMILES | CC.COc1cc2nc(C)c(C)nc2c(C)c1OC |
| InChI | InChI=1S/C13H16N2O2.C2H6/c1-7-12-10(14-8(2)9(3)15-12)6-11(16-4)13(7)17-5;1-2/h6H,1-5H3;1-2H3 |
| InChIKey | LBUUSRTWYSZEJP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane?
The IUPAC name of 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane (CID 142406263) is 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane.
What is the SMILES notation for 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane?
The canonical SMILES for 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane is CC.COc1cc2nc(C)c(C)nc2c(C)c1OC.
What is the InChIKey of 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane?
The InChIKey is LBUUSRTWYSZEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2.C2H6/c1-7-12-10(14-8(2)9(3)15-12)6-11(16-4)13(7)17-5;1-2/h6H,1-5H3;1-2H3.
What are the key properties of 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane?
6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane has a molecular weight of 262.35 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2,3,5-trimethylquinoxaline;ethane is sourced from PubChem (CID 142406263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).