C12H14N2O — CID 121009492
5-methoxy-2,3,8-trimethylquinoxaline (PubChem CID 121009492) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-methoxy-2,3,8-trimethylquinoxaline.
| Compound Name | 5-methoxy-2,3,8-trimethylquinoxaline |
|---|---|
| PubChem CID | 121009492 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 5-methoxy-2,3,8-trimethylquinoxaline |
| SMILES | COc1ccc(C)c2nc(C)c(C)nc12 |
| InChI | InChI=1S/C12H14N2O/c1-7-5-6-10(15-4)12-11(7)13-8(2)9(3)14-12/h5-6H,1-4H3 |
| InChIKey | FPZGOVIRXADNNU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |