C14H18N2O2S2 — CID 15350040
2,3-bis(ethylsulfanyl)-5,8-dimethoxyquinoxaline (PubChem CID 15350040) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2,3-bis(ethylsulfanyl)-5,8-dimethoxyquinoxaline.
| Compound Name | 2,3-bis(ethylsulfanyl)-5,8-dimethoxyquinoxaline |
|---|---|
| PubChem CID | 15350040 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2,3-bis(ethylsulfanyl)-5,8-dimethoxyquinoxaline |
| SMILES | CCSc1nc2c(OC)ccc(OC)c2nc1SCC |
| InChI | InChI=1S/C14H18N2O2S2/c1-5-19-13-14(20-6-2)16-12-10(18-4)8-7-9(17-3)11(12)15-13/h7-8H,5-6H2,1-4H3 |
| InChIKey | RMRICQPTHVPACG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |