C12H12ClNO2 — CID 174844835
3-chloro-6,7-dimethoxy-2-methylquinoline (PubChem CID 174844835) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 3-chloro-6,7-dimethoxy-2-methylquinoline.
| Compound Name | 3-chloro-6,7-dimethoxy-2-methylquinoline |
|---|---|
| PubChem CID | 174844835 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-chloro-6,7-dimethoxy-2-methylquinoline |
| SMILES | COc1cc2cc(Cl)c(C)nc2cc1OC |
| InChI | InChI=1S/C12H12ClNO2/c1-7-9(13)4-8-5-11(15-2)12(16-3)6-10(8)14-7/h4-6H,1-3H3 |
| InChIKey | WDALSEUOFXNTKK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |