C12H9ClN4O — CID 84638408
8-chloro-7-methoxypyrimido[4,5-b]quinolin-2-amine (PubChem CID 84638408) has the molecular formula C12H9ClN4O and a molecular weight of 260.68 g/mol. Its IUPAC name is 8-chloro-7-methoxypyrimido[4,5-b]quinolin-2-amine.
| Compound Name | 8-chloro-7-methoxypyrimido[4,5-b]quinolin-2-amine |
|---|---|
| PubChem CID | 84638408 |
| Molecular Formula | C12H9ClN4O |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 8-chloro-7-methoxypyrimido[4,5-b]quinolin-2-amine |
| SMILES | COc1cc2cc3cnc(N)nc3nc2cc1Cl |
| InChI | InChI=1S/C12H9ClN4O/c1-18-10-3-6-2-7-5-15-12(14)17-11(7)16-9(6)4-8(10)13/h2-5H,1H3,(H2,14,15,16,17) |
| InChIKey | UWJWYMYQYQISBI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|