C11H8N4 — CID 10987174
pyrimido[4,5-b]quinolin-2-amine (PubChem CID 10987174) has the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. Its IUPAC name is pyrimido[4,5-b]quinolin-2-amine.
| Compound Name | pyrimido[4,5-b]quinolin-2-amine |
|---|---|
| PubChem CID | 10987174 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | pyrimido[4,5-b]quinolin-2-amine |
| SMILES | Nc1ncc2cc3ccccc3nc2n1 |
| InChI | InChI=1S/C11H8N4/c12-11-13-6-8-5-7-3-1-2-4-9(7)14-10(8)15-11/h1-6H,(H2,12,13,14,15) |
| InChIKey | IYGDHZNUZSJLLJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|