C15H17N5 — CID 91413319
ethane;6-phenylpyrido[2,3-d]pyrimidine-2,7-diamine (PubChem CID 91413319) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is ethane;6-phenylpyrido[2,3-d]pyrimidine-2,7-diamine.
| Compound Name | ethane;6-phenylpyrido[2,3-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 91413319 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | ethane;6-phenylpyrido[2,3-d]pyrimidine-2,7-diamine |
| SMILES | CC.Nc1ncc2cc(-c3ccccc3)c(N)nc2n1 |
| InChI | InChI=1S/C13H11N5.C2H6/c14-11-10(8-4-2-1-3-5-8)6-9-7-16-13(15)18-12(9)17-11;1-2/h1-7H,(H4,14,15,16,17,18);1-2H3 |
| InChIKey | HFHKCNVWOKHQBD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |