C11H11N3 — CID 118999182
5-phenylpyridine-2,4-diamine (PubChem CID 118999182) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-phenylpyridine-2,4-diamine.
| Compound Name | 5-phenylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 118999182 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 5-phenylpyridine-2,4-diamine |
| SMILES | Nc1cc(N)c(-c2ccccc2)cn1 |
| InChI | InChI=1S/C11H11N3/c12-10-6-11(13)14-7-9(10)8-4-2-1-3-5-8/h1-7H,(H4,12,13,14) |
| InChIKey | NUGRNDVPTIQDMH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |