C17H12BrN — CID 118667529
2-bromo-4,5-diphenylpyridine (PubChem CID 118667529) has the molecular formula C17H12BrN and a molecular weight of 310.19 g/mol. Its IUPAC name is 2-bromo-4,5-diphenylpyridine.
| Compound Name | 2-bromo-4,5-diphenylpyridine |
|---|---|
| PubChem CID | 118667529 |
| Molecular Formula | C17H12BrN |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-bromo-4,5-diphenylpyridine |
| SMILES | Brc1cc(-c2ccccc2)c(-c2ccccc2)cn1 |
| InChI | InChI=1S/C17H12BrN/c18-17-11-15(13-7-3-1-4-8-13)16(12-19-17)14-9-5-2-6-10-14/h1-12H |
| InChIKey | GLHZOIWAMKBUOR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|