About 2-bromo-4,5-diphenylpyridine
2-bromo-4,5-diphenylpyridine (PubChem CID 118667529) has the molecular formula C17H12BrN
and a molecular weight of 310.19 g/mol. Its IUPAC name is 2-bromo-4,5-diphenylpyridine.
Molecular Properties
| Compound Name | 2-bromo-4,5-diphenylpyridine |
| PubChem CID | 118667529 |
| Molecular Formula | C17H12BrN |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-bromo-4,5-diphenylpyridine |
| SMILES | Brc1cc(-c2ccccc2)c(-c2ccccc2)cn1 |
| InChI | InChI=1S/C17H12BrN/c18-17-11-15(13-7-3-1-4-8-13)16(12-19-17)14-9-5-2-6-10-14/h1-12H |
| InChIKey | GLHZOIWAMKBUOR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4,5-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,5-diphenylpyridine?
The IUPAC name of 2-bromo-4,5-diphenylpyridine (CID 118667529) is 2-bromo-4,5-diphenylpyridine.
What is the SMILES notation for 2-bromo-4,5-diphenylpyridine?
The canonical SMILES for 2-bromo-4,5-diphenylpyridine is Brc1cc(-c2ccccc2)c(-c2ccccc2)cn1.
What is the InChIKey of 2-bromo-4,5-diphenylpyridine?
The InChIKey is GLHZOIWAMKBUOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrN/c18-17-11-15(13-7-3-1-4-8-13)16(12-19-17)14-9-5-2-6-10-14/h1-12H.
What are the key properties of 2-bromo-4,5-diphenylpyridine?
2-bromo-4,5-diphenylpyridine has a molecular weight of 310.19 g/mol, XLogP of 5.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,5-diphenylpyridine is sourced from PubChem (CID 118667529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).