C10H10N4 — CID 89253384
4-phenylpyrimidine-2,5-diamine (PubChem CID 89253384) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 4-phenylpyrimidine-2,5-diamine.
| Compound Name | 4-phenylpyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 89253384 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-phenylpyrimidine-2,5-diamine |
| SMILES | Nc1ncc(N)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H10N4/c11-8-6-13-10(12)14-9(8)7-4-2-1-3-5-7/h1-6H,11H2,(H2,12,13,14) |
| InChIKey | NAZORHVMBDYNQT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |