C14H11N3O — CID 134140522
4-(furan-2-yl)-5-phenylpyrimidin-2-amine (PubChem CID 134140522) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-(furan-2-yl)-5-phenylpyrimidin-2-amine.
| Compound Name | 4-(furan-2-yl)-5-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 134140522 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-(furan-2-yl)-5-phenylpyrimidin-2-amine |
| SMILES | Nc1ncc(-c2ccccc2)c(-c2ccco2)n1 |
| InChI | InChI=1S/C14H11N3O/c15-14-16-9-11(10-5-2-1-3-6-10)13(17-14)12-7-4-8-18-12/h1-9H,(H2,15,16,17) |
| InChIKey | SAWJQCBLHCBENI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |