C15H13N5O3 — CID 59749186
2-[5-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-2-oxo-1-pyridinyl]acetamide (PubChem CID 59749186) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-[5-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-2-oxo-1-pyridinyl]acetamide.
| Compound Name | 2-[5-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 59749186 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-[5-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-2-oxo-1-pyridinyl]acetamide |
| SMILES | NC(=O)Cn1cc(-c2cnc(N)nc2-c2ccco2)ccc1=O |
| InChI | InChI=1S/C15H13N5O3/c16-12(21)8-20-7-9(3-4-13(20)22)10-6-18-15(17)19-14(10)11-2-1-5-23-11/h1-7H,8H2,(H2,16,21)(H2,17,18,19) |
| InChIKey | ATZSEJHMUNYGAT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |