C17H14N4O2 — CID 59749102
4-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-1-but-2-ynylpyridin-2-one (PubChem CID 59749102) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 4-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-1-but-2-ynylpyridin-2-one.
| Compound Name | 4-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-1-but-2-ynylpyridin-2-one |
|---|---|
| PubChem CID | 59749102 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 4-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-1-but-2-ynylpyridin-2-one |
| SMILES | CC#CCn1ccc(-c2cnc(N)nc2-c2ccco2)cc1=O |
| InChI | InChI=1S/C17H14N4O2/c1-2-3-7-21-8-6-12(10-15(21)22)13-11-19-17(18)20-16(13)14-5-4-9-23-14/h4-6,8-11H,7H2,1H3,(H2,18,19,20) |
| InChIKey | UZMMPKPVKUOCHK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|