C16H15FN4O2 — CID 59749154
5-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-1-(3-fluoropropyl)pyridin-2-one (PubChem CID 59749154) has the molecular formula C16H15FN4O2 and a molecular weight of 314.32 g/mol. Its IUPAC name is 5-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-1-(3-fluoropropyl)pyridin-2-one.
| Compound Name | 5-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-1-(3-fluoropropyl)pyridin-2-one |
|---|---|
| PubChem CID | 59749154 |
| Molecular Formula | C16H15FN4O2 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 5-[2-amino-4-(furan-2-yl)pyrimidin-5-yl]-1-(3-fluoropropyl)pyridin-2-one |
| SMILES | Nc1ncc(-c2ccc(=O)n(CCCF)c2)c(-c2ccco2)n1 |
| InChI | InChI=1S/C16H15FN4O2/c17-6-2-7-21-10-11(4-5-14(21)22)12-9-19-16(18)20-15(12)13-3-1-8-23-13/h1,3-5,8-10H,2,6-7H2,(H2,18,19,20) |
| InChIKey | SUWRTGZCPNRRNT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |