C24H31N5O3 — CID 22708095
2-amino-N-[3-(diethylamino)propyl]-5-(1-ethyl-6-oxo-3-pyridinyl)-6-(furan-2-yl)pyridine-3-carboxamide (PubChem CID 22708095) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-amino-N-[3-(diethylamino)propyl]-5-(1-ethyl-6-oxo-3-pyridinyl)-6-(furan-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[3-(diethylamino)propyl]-5-(1-ethyl-6-oxo-3-pyridinyl)-6-(furan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22708095 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 2-amino-N-[3-(diethylamino)propyl]-5-(1-ethyl-6-oxo-3-pyridinyl)-6-(furan-2-yl)pyridine-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1cc(-c2ccc(=O)n(CC)c2)c(-c2ccco2)nc1N |
| InChI | InChI=1S/C24H31N5O3/c1-4-28(5-2)13-8-12-26-24(31)19-15-18(17-10-11-21(30)29(6-3)16-17)22(27-23(19)25)20-9-7-14-32-20/h7,9-11,14-16H,4-6,8,12-13H2,1-3H3,(H2,25,27)(H,26,31) |
| InChIKey | FJMGNXPGGDVRJQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|