C12H12N6O2 — CID 59834969
2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-methylacetamide (PubChem CID 59834969) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-methylacetamide.
| Compound Name | 2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 59834969 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cn1cnc2c(-c3ccco3)nc(N)nc21 |
| InChI | InChI=1S/C12H12N6O2/c1-14-8(19)5-18-6-15-10-9(7-3-2-4-20-7)16-12(13)17-11(10)18/h2-4,6H,5H2,1H3,(H,14,19)(H2,13,16,17) |
| InChIKey | NPUAYULMTSTCBA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |