C17H16N6O — CID 59835097
6-(furan-2-yl)-9-(3-pyridin-4-ylpropyl)purin-2-amine (PubChem CID 59835097) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 6-(furan-2-yl)-9-(3-pyridin-4-ylpropyl)purin-2-amine.
| Compound Name | 6-(furan-2-yl)-9-(3-pyridin-4-ylpropyl)purin-2-amine |
|---|---|
| PubChem CID | 59835097 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 6-(furan-2-yl)-9-(3-pyridin-4-ylpropyl)purin-2-amine |
| SMILES | Nc1nc(-c2ccco2)c2ncn(CCCc3ccncc3)c2n1 |
| InChI | InChI=1S/C17H16N6O/c18-17-21-14(13-4-2-10-24-13)15-16(22-17)23(11-20-15)9-1-3-12-5-7-19-8-6-12/h2,4-8,10-11H,1,3,9H2,(H2,18,21,22) |
| InChIKey | YTDRZSCZMZYAEP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |