C18H16N6O3 — CID 58758762
2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 58758762) has the molecular formula C18H16N6O3 and a molecular weight of 364.37 g/mol. Its IUPAC name is 2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 58758762 |
| Molecular Formula | C18H16N6O3 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)Cn2cnc3c(-c4ccco4)nc(N)nc32)c1 |
| InChI | InChI=1S/C18H16N6O3/c1-26-12-5-2-4-11(8-12)21-14(25)9-24-10-20-16-15(13-6-3-7-27-13)22-18(19)23-17(16)24/h2-8,10H,9H2,1H3,(H,21,25)(H2,19,22,23) |
| InChIKey | PJOZUABPHJBLII-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |