C17H16N4O5S — CID 121090719
2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]-N-[3-(methanesulfonamido)phenyl]acetamide (PubChem CID 121090719) has the molecular formula C17H16N4O5S and a molecular weight of 388.41 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]-N-[3-(methanesulfonamido)phenyl]acetamide.
| Compound Name | 2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]-N-[3-(methanesulfonamido)phenyl]acetamide |
|---|---|
| PubChem CID | 121090719 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]-N-[3-(methanesulfonamido)phenyl]acetamide |
| SMILES | CS(=O)(=O)Nc1cccc(NC(=O)Cn2cnc(-c3ccco3)cc2=O)c1 |
| InChI | InChI=1S/C17H16N4O5S/c1-27(24,25)20-13-5-2-4-12(8-13)19-16(22)10-21-11-18-14(9-17(21)23)15-6-3-7-26-15/h2-9,11,20H,10H2,1H3,(H,19,22) |
| InChIKey | ASFMOKSOBPNSJT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |