C19H13N3O5 — CID 121090653
2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]-N-(2-oxochromen-3-yl)acetamide (PubChem CID 121090653) has the molecular formula C19H13N3O5 and a molecular weight of 363.33 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]-N-(2-oxochromen-3-yl)acetamide.
| Compound Name | 2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]-N-(2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 121090653 |
| Molecular Formula | C19H13N3O5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]-N-(2-oxochromen-3-yl)acetamide |
| SMILES | O=C(Cn1cnc(-c2ccco2)cc1=O)Nc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H13N3O5/c23-17(21-14-8-12-4-1-2-5-15(12)27-19(14)25)10-22-11-20-13(9-18(22)24)16-6-3-7-26-16/h1-9,11H,10H2,(H,21,23) |
| InChIKey | CDSOTZJINGTGAS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|