C25H17N3O4 — CID 121051465
2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)-N-(2-oxochromen-3-yl)acetamide (PubChem CID 121051465) has the molecular formula C25H17N3O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)-N-(2-oxochromen-3-yl)acetamide.
| Compound Name | 2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)-N-(2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 121051465 |
| Molecular Formula | C25H17N3O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)-N-(2-oxochromen-3-yl)acetamide |
| SMILES | O=C(Cn1nc(-c2ccc3ccccc3c2)ccc1=O)Nc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C25H17N3O4/c29-23(26-21-14-19-7-3-4-8-22(19)32-25(21)31)15-28-24(30)12-11-20(27-28)18-10-9-16-5-1-2-6-17(16)13-18/h1-14H,15H2,(H,26,29) |
| InChIKey | IQEFBHMHEIYNGO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|