C23H19N3O6 — CID 121050267
2-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(2-oxochromen-3-yl)acetamide (PubChem CID 121050267) has the molecular formula C23H19N3O6 and a molecular weight of 433.42 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(2-oxochromen-3-yl)acetamide.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 121050267 |
| Molecular Formula | C23H19N3O6 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-(2-oxochromen-3-yl)acetamide |
| SMILES | COc1ccc(-c2ccc(=O)n(CC(=O)Nc3cc4ccccc4oc3=O)n2)cc1OC |
| InChI | InChI=1S/C23H19N3O6/c1-30-19-9-7-14(12-20(19)31-2)16-8-10-22(28)26(25-16)13-21(27)24-17-11-15-5-3-4-6-18(15)32-23(17)29/h3-12H,13H2,1-2H3,(H,24,27) |
| InChIKey | XPAODYYPEADRHZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|