C22H23N5O5 — CID 121090735
N-[2-[[2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]acetyl]amino]ethyl]-4-(propanoylamino)benzamide (PubChem CID 121090735) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is N-[2-[[2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]acetyl]amino]ethyl]-4-(propanoylamino)benzamide.
| Compound Name | N-[2-[[2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]acetyl]amino]ethyl]-4-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 121090735 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[2-[[2-[4-(furan-2-yl)-6-oxopyrimidin-1-yl]acetyl]amino]ethyl]-4-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)NCCNC(=O)Cn2cnc(-c3ccco3)cc2=O)cc1 |
| InChI | InChI=1S/C22H23N5O5/c1-2-19(28)26-16-7-5-15(6-8-16)22(31)24-10-9-23-20(29)13-27-14-25-17(12-21(27)30)18-4-3-11-32-18/h3-8,11-12,14H,2,9-10,13H2,1H3,(H,23,29)(H,24,31)(H,26,28) |
| InChIKey | YMZWWGXKEPVRKQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 135.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|