C24H27N5O4S — CID 121090941
4-(2,2-dimethylpropanoylamino)-N-[2-[[2-(6-oxo-4-thiophen-2-ylpyrimidin-1-yl)acetyl]amino]ethyl]benzamide (PubChem CID 121090941) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoylamino)-N-[2-[[2-(6-oxo-4-thiophen-2-ylpyrimidin-1-yl)acetyl]amino]ethyl]benzamide.
| Compound Name | 4-(2,2-dimethylpropanoylamino)-N-[2-[[2-(6-oxo-4-thiophen-2-ylpyrimidin-1-yl)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121090941 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 4-(2,2-dimethylpropanoylamino)-N-[2-[[2-(6-oxo-4-thiophen-2-ylpyrimidin-1-yl)acetyl]amino]ethyl]benzamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(C(=O)NCCNC(=O)Cn2cnc(-c3cccs3)cc2=O)cc1 |
| InChI | InChI=1S/C24H27N5O4S/c1-24(2,3)23(33)28-17-8-6-16(7-9-17)22(32)26-11-10-25-20(30)14-29-15-27-18(13-21(29)31)19-5-4-12-34-19/h4-9,12-13,15H,10-11,14H2,1-3H3,(H,25,30)(H,26,32)(H,28,33) |
| InChIKey | DJKXFXBVWFNFOZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|