C28H33N5O4 — CID 121051981
N-[2-[[2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]acetyl]amino]ethyl]-4-(2,2-dimethylpropanoylamino)benzamide (PubChem CID 121051981) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[2-[[2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]acetyl]amino]ethyl]-4-(2,2-dimethylpropanoylamino)benzamide.
| Compound Name | N-[2-[[2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]acetyl]amino]ethyl]-4-(2,2-dimethylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 121051981 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-[2-[[2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]acetyl]amino]ethyl]-4-(2,2-dimethylpropanoylamino)benzamide |
| SMILES | Cc1ccc(C)c(-c2ccc(=O)n(CC(=O)NCCNC(=O)c3ccc(NC(=O)C(C)(C)C)cc3)n2)c1 |
| InChI | InChI=1S/C28H33N5O4/c1-18-6-7-19(2)22(16-18)23-12-13-25(35)33(32-23)17-24(34)29-14-15-30-26(36)20-8-10-21(11-9-20)31-27(37)28(3,4)5/h6-13,16H,14-15,17H2,1-5H3,(H,29,34)(H,30,36)(H,31,37) |
| InChIKey | MWIKMJHTIVYLSZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|