C24H25N5O4S — CID 121076669
4-(cyclopropanecarbonylamino)-N-[2-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)propanoylamino]ethyl]benzamide (PubChem CID 121076669) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is 4-(cyclopropanecarbonylamino)-N-[2-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)propanoylamino]ethyl]benzamide.
| Compound Name | 4-(cyclopropanecarbonylamino)-N-[2-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)propanoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 121076669 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 4-(cyclopropanecarbonylamino)-N-[2-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)propanoylamino]ethyl]benzamide |
| SMILES | CC(C(=O)NCCNC(=O)c1ccc(NC(=O)C2CC2)cc1)n1nc(-c2cccs2)ccc1=O |
| InChI | InChI=1S/C24H25N5O4S/c1-15(29-21(30)11-10-19(28-29)20-3-2-14-34-20)22(31)25-12-13-26-23(32)16-6-8-18(9-7-16)27-24(33)17-4-5-17/h2-3,6-11,14-15,17H,4-5,12-13H2,1H3,(H,25,31)(H,26,32)(H,27,33) |
| InChIKey | ICQZDRHETDWCQL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|