C27H29N5O4 — CID 121050984
4-(cyclopropanecarbonylamino)-N-[2-[[2-[3-(4-ethylphenyl)-6-oxopyridazin-1-yl]acetyl]amino]ethyl]benzamide (PubChem CID 121050984) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 4-(cyclopropanecarbonylamino)-N-[2-[[2-[3-(4-ethylphenyl)-6-oxopyridazin-1-yl]acetyl]amino]ethyl]benzamide.
| Compound Name | 4-(cyclopropanecarbonylamino)-N-[2-[[2-[3-(4-ethylphenyl)-6-oxopyridazin-1-yl]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121050984 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 4-(cyclopropanecarbonylamino)-N-[2-[[2-[3-(4-ethylphenyl)-6-oxopyridazin-1-yl]acetyl]amino]ethyl]benzamide |
| SMILES | CCc1ccc(-c2ccc(=O)n(CC(=O)NCCNC(=O)c3ccc(NC(=O)C4CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C27H29N5O4/c1-2-18-3-5-19(6-4-18)23-13-14-25(34)32(31-23)17-24(33)28-15-16-29-26(35)20-9-11-22(12-10-20)30-27(36)21-7-8-21/h3-6,9-14,21H,2,7-8,15-17H2,1H3,(H,28,33)(H,29,35)(H,30,36) |
| InChIKey | BYPXYKUSEHCRCE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|