C25H25N5O4 — CID 121050109
4-(cyclopropanecarbonylamino)-N-[2-[[2-(6-oxo-3-phenylpyridazin-1-yl)acetyl]amino]ethyl]benzamide (PubChem CID 121050109) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is 4-(cyclopropanecarbonylamino)-N-[2-[[2-(6-oxo-3-phenylpyridazin-1-yl)acetyl]amino]ethyl]benzamide.
| Compound Name | 4-(cyclopropanecarbonylamino)-N-[2-[[2-(6-oxo-3-phenylpyridazin-1-yl)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121050109 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 4-(cyclopropanecarbonylamino)-N-[2-[[2-(6-oxo-3-phenylpyridazin-1-yl)acetyl]amino]ethyl]benzamide |
| SMILES | O=C(Cn1nc(-c2ccccc2)ccc1=O)NCCNC(=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C25H25N5O4/c31-22(16-30-23(32)13-12-21(29-30)17-4-2-1-3-5-17)26-14-15-27-24(33)18-8-10-20(11-9-18)28-25(34)19-6-7-19/h1-5,8-13,19H,6-7,14-16H2,(H,26,31)(H,27,33)(H,28,34) |
| InChIKey | CBUVASAWOFZAEJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|