C14H16N6O2 — CID 59835055
2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-propylacetamide (PubChem CID 59835055) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-propylacetamide.
| Compound Name | 2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 59835055 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[2-amino-6-(furan-2-yl)purin-9-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)Cn1cnc2c(-c3ccco3)nc(N)nc21 |
| InChI | InChI=1S/C14H16N6O2/c1-2-5-16-10(21)7-20-8-17-12-11(9-4-3-6-22-9)18-14(15)19-13(12)20/h3-4,6,8H,2,5,7H2,1H3,(H,16,21)(H2,15,18,19) |
| InChIKey | NGDJEYACQNLWHQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |