C12H8F3N3O — CID 15851436
1-(2-amino-4-phenylpyrimidin-5-yl)-2,2,2-trifluoroethanone (PubChem CID 15851436) has the molecular formula C12H8F3N3O and a molecular weight of 267.21 g/mol. Its IUPAC name is 1-(2-amino-4-phenylpyrimidin-5-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(2-amino-4-phenylpyrimidin-5-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 15851436 |
| Molecular Formula | C12H8F3N3O |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(2-amino-4-phenylpyrimidin-5-yl)-2,2,2-trifluoroethanone |
| SMILES | Nc1ncc(C(=O)C(F)(F)F)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H8F3N3O/c13-12(14,15)10(19)8-6-17-11(16)18-9(8)7-4-2-1-3-5-7/h1-6H,(H2,16,17,18) |
| InChIKey | VZVVYSXIAABFEM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |