C20H18N5+ — CID 58524836
[4-(2-amino-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methylazanium (PubChem CID 58524836) has the molecular formula C20H18N5+ and a molecular weight of 328.40 g/mol. Its IUPAC name is [4-(2-amino-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methylazanium.
| Compound Name | [4-(2-amino-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methylazanium |
|---|---|
| PubChem CID | 58524836 |
| Molecular Formula | C20H18N5+ |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [4-(2-amino-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methylazanium |
| SMILES | Nc1ncc2cc(-c3ccccc3)c(-c3ccc(C[NH3+])cc3)nc2n1 |
| InChI | InChI=1S/C20H17N5/c21-11-13-6-8-15(9-7-13)18-17(14-4-2-1-3-5-14)10-16-12-23-20(22)25-19(16)24-18/h1-10,12H,11,21H2,(H2,22,23,24,25)/p+1 |
| InChIKey | WYPWNTAYLZIBJR-UHFFFAOYSA-O |
| XLogP | 2.68 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |