C27H23Cl2N3 — CID 86659519
[4-(3,5-diphenyl-1,6-naphthyridin-6-ium-2-yl)phenyl]methylazanium dichloride (PubChem CID 86659519) has the molecular formula C27H23Cl2N3 and a molecular weight of 460.41 g/mol. Its IUPAC name is [4-(3,5-diphenyl-1,6-naphthyridin-6-ium-2-yl)phenyl]methylazanium dichloride.
| Compound Name | [4-(3,5-diphenyl-1,6-naphthyridin-6-ium-2-yl)phenyl]methylazanium dichloride |
|---|---|
| PubChem CID | 86659519 |
| Molecular Formula | C27H23Cl2N3 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [4-(3,5-diphenyl-1,6-naphthyridin-6-ium-2-yl)phenyl]methylazanium dichloride |
| SMILES | [Cl-].[Cl-].[NH3+]Cc1ccc(-c2nc3cc[nH+]c(-c4ccccc4)c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21N3.2ClH/c28-18-19-11-13-22(14-12-19)27-23(20-7-3-1-4-8-20)17-24-25(30-27)15-16-29-26(24)21-9-5-2-6-10-21;;/h1-17H,18,28H2;2*1H |
| InChIKey | XKCDIUBRXNCBRC-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |