C22H17N4+ — CID 58524392
[4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methylazanium (PubChem CID 58524392) has the molecular formula C22H17N4+ and a molecular weight of 337.41 g/mol. Its IUPAC name is [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methylazanium.
| Compound Name | [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methylazanium |
|---|---|
| PubChem CID | 58524392 |
| Molecular Formula | C22H17N4+ |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methylazanium |
| SMILES | N#Cc1nccc2nc(-c3ccc(C[NH3+])cc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C22H16N4/c23-13-15-6-8-17(9-7-15)22-18(16-4-2-1-3-5-16)12-19-20(26-22)10-11-25-21(19)14-24/h1-12H,13,23H2/p+1 |
| InChIKey | JJRHATULNZZFPW-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |