About 3-chlorobenzo[b][1,8]naphthyridine
3-chlorobenzo[b][1,8]naphthyridine (PubChem CID 66875221) has the molecular formula C12H7ClN2
and a molecular weight of 214.66 g/mol. Its IUPAC name is 3-chlorobenzo[b][1,8]naphthyridine.
Molecular Properties
| Compound Name | 3-chlorobenzo[b][1,8]naphthyridine |
| PubChem CID | 66875221 |
| Molecular Formula | C12H7ClN2 |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 3-chlorobenzo[b][1,8]naphthyridine |
| SMILES | Clc1cnc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C12H7ClN2/c13-10-6-9-5-8-3-1-2-4-11(8)15-12(9)14-7-10/h1-7H |
| InChIKey | KUNCSDBKQUGXHS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzo[b][1,8]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzo[b][1,8]naphthyridine?
The IUPAC name of 3-chlorobenzo[b][1,8]naphthyridine (CID 66875221) is 3-chlorobenzo[b][1,8]naphthyridine.
What is the SMILES notation for 3-chlorobenzo[b][1,8]naphthyridine?
The canonical SMILES for 3-chlorobenzo[b][1,8]naphthyridine is Clc1cnc2nc3ccccc3cc2c1.
What is the InChIKey of 3-chlorobenzo[b][1,8]naphthyridine?
The InChIKey is KUNCSDBKQUGXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClN2/c13-10-6-9-5-8-3-1-2-4-11(8)15-12(9)14-7-10/h1-7H.
What are the key properties of 3-chlorobenzo[b][1,8]naphthyridine?
3-chlorobenzo[b][1,8]naphthyridine has a molecular weight of 214.66 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzo[b][1,8]naphthyridine is sourced from PubChem (CID 66875221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).