C25H23NO3 — CID 155930832
2-benzyl-5,6,7-trimethoxy-3-phenylquinoline (PubChem CID 155930832) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-benzyl-5,6,7-trimethoxy-3-phenylquinoline.
| Compound Name | 2-benzyl-5,6,7-trimethoxy-3-phenylquinoline |
|---|---|
| PubChem CID | 155930832 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-benzyl-5,6,7-trimethoxy-3-phenylquinoline |
| SMILES | COc1cc2nc(Cc3ccccc3)c(-c3ccccc3)cc2c(OC)c1OC |
| InChI | InChI=1S/C25H23NO3/c1-27-23-16-22-20(24(28-2)25(23)29-3)15-19(18-12-8-5-9-13-18)21(26-22)14-17-10-6-4-7-11-17/h4-13,15-16H,14H2,1-3H3 |
| InChIKey | PABNEIAZWWGDPQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |