C26H26O6 — CID 162399745
6,7-dimethoxy-3-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene (PubChem CID 162399745) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 6,7-dimethoxy-3-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene.
| Compound Name | 6,7-dimethoxy-3-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene |
|---|---|
| PubChem CID | 162399745 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 6,7-dimethoxy-3-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene |
| SMILES | COc1cc2c(cc1OC)C(c1cc(OC)c(OC)c(OC)c1)=C(c1ccccc1)CO2 |
| InChI | InChI=1S/C26H26O6/c1-27-21-13-18-20(14-22(21)28-2)32-15-19(16-9-7-6-8-10-16)25(18)17-11-23(29-3)26(31-5)24(12-17)30-4/h6-14H,15H2,1-5H3 |
| InChIKey | SGEPVTYENJQWTH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|