C24H22O6 — CID 122699413
3-(4-hydroxy-3,5-dimethoxyphenyl)-4-(4-hydroxyphenyl)-6-methyl-2H-chromen-7-ol (PubChem CID 122699413) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)-4-(4-hydroxyphenyl)-6-methyl-2H-chromen-7-ol.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-4-(4-hydroxyphenyl)-6-methyl-2H-chromen-7-ol |
|---|---|
| PubChem CID | 122699413 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-4-(4-hydroxyphenyl)-6-methyl-2H-chromen-7-ol |
| SMILES | COc1cc(C2=C(c3ccc(O)cc3)c3cc(C)c(O)cc3OC2)cc(OC)c1O |
| InChI | InChI=1S/C24H22O6/c1-13-8-17-20(11-19(13)26)30-12-18(23(17)14-4-6-16(25)7-5-14)15-9-21(28-2)24(27)22(10-15)29-3/h4-11,25-27H,12H2,1-3H3 |
| InChIKey | VWQYHLGDOVBCOG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|