C25H22F2O6 — CID 118296068
4-(3,5-difluoro-4-hydroxyphenyl)-8-methyl-3-(3,4,5-trimethoxyphenyl)-2H-chromen-7-ol (PubChem CID 118296068) has the molecular formula C25H22F2O6 and a molecular weight of 456.44 g/mol. Its IUPAC name is 4-(3,5-difluoro-4-hydroxyphenyl)-8-methyl-3-(3,4,5-trimethoxyphenyl)-2H-chromen-7-ol.
| Compound Name | 4-(3,5-difluoro-4-hydroxyphenyl)-8-methyl-3-(3,4,5-trimethoxyphenyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 118296068 |
| Molecular Formula | C25H22F2O6 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 4-(3,5-difluoro-4-hydroxyphenyl)-8-methyl-3-(3,4,5-trimethoxyphenyl)-2H-chromen-7-ol |
| SMILES | COc1cc(C2=C(c3cc(F)c(O)c(F)c3)c3ccc(O)c(C)c3OC2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22F2O6/c1-12-19(28)6-5-15-22(14-7-17(26)23(29)18(27)8-14)16(11-33-24(12)15)13-9-20(30-2)25(32-4)21(10-13)31-3/h5-10,28-29H,11H2,1-4H3 |
| InChIKey | WLWMDYCVJJYQGN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|