C26H25FO6 — CID 122699469
4-(3-fluoro-4-hydroxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)-8-propyl-2H-chromen-7-ol (PubChem CID 122699469) has the molecular formula C26H25FO6 and a molecular weight of 452.48 g/mol. Its IUPAC name is 4-(3-fluoro-4-hydroxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)-8-propyl-2H-chromen-7-ol.
| Compound Name | 4-(3-fluoro-4-hydroxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)-8-propyl-2H-chromen-7-ol |
|---|---|
| PubChem CID | 122699469 |
| Molecular Formula | C26H25FO6 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-(3-fluoro-4-hydroxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)-8-propyl-2H-chromen-7-ol |
| SMILES | CCCc1c(O)ccc2c1OCC(c1cc(OC)c(O)c(OC)c1)=C2c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C26H25FO6/c1-4-5-16-20(28)9-7-17-24(14-6-8-21(29)19(27)10-14)18(13-33-26(16)17)15-11-22(31-2)25(30)23(12-15)32-3/h6-12,28-30H,4-5,13H2,1-3H3 |
| InChIKey | IBAFAPSOMVRWMZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|