C23H22O6 — CID 130286345
5-[7-hydroxy-4-(4-hydroxyphenyl)-6-methyl-3,4-dihydro-2H-chromen-3-yl]-3-methoxybenzene-1,2-diol (PubChem CID 130286345) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is 5-[7-hydroxy-4-(4-hydroxyphenyl)-6-methyl-3,4-dihydro-2H-chromen-3-yl]-3-methoxybenzene-1,2-diol.
| Compound Name | 5-[7-hydroxy-4-(4-hydroxyphenyl)-6-methyl-3,4-dihydro-2H-chromen-3-yl]-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 130286345 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5-[7-hydroxy-4-(4-hydroxyphenyl)-6-methyl-3,4-dihydro-2H-chromen-3-yl]-3-methoxybenzene-1,2-diol |
| SMILES | COc1cc(C2COc3cc(O)c(C)cc3C2c2ccc(O)cc2)cc(O)c1O |
| InChI | InChI=1S/C23H22O6/c1-12-7-16-20(10-18(12)25)29-11-17(22(16)13-3-5-15(24)6-4-13)14-8-19(26)23(27)21(9-14)28-2/h3-10,17,22,24-27H,11H2,1-2H3 |
| InChIKey | PUMDTPJVASDJIF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|