C21H18O4 — CID 146292723
(4S)-3,4-bis(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol (PubChem CID 146292723) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is (4S)-3,4-bis(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | (4S)-3,4-bis(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 146292723 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (4S)-3,4-bis(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Oc1ccc(C2COc3cc(O)ccc3[C@@H]2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H18O4/c22-15-5-1-13(2-6-15)19-12-25-20-11-17(24)9-10-18(20)21(19)14-3-7-16(23)8-4-14/h1-11,19,21-24H,12H2/t19?,21-/m0/s1 |
| InChIKey | VXHSDGZMRLGSEJ-QWAKEFERSA-N |
| XLogP | 4.11 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |