C21H19NO3 — CID 58035760
4-(3-aminophenyl)-3-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol (PubChem CID 58035760) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-(3-aminophenyl)-3-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | 4-(3-aminophenyl)-3-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 58035760 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-(3-aminophenyl)-3-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Nc1cccc(C2c3ccc(O)cc3OCC2c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C21H19NO3/c22-15-3-1-2-14(10-15)21-18-9-8-17(24)11-20(18)25-12-19(21)13-4-6-16(23)7-5-13/h1-11,19,21,23-24H,12,22H2 |
| InChIKey | NYPDDQKXFGEDBJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|