C25H26N2O2 — CID 175906738
(3S,4R)-4-[4-(4-deuteriopiperazin-1-yl)phenyl]-3-phenyl-3,4-dihydro-2H-chromen-7-ol (PubChem CID 175906738) has the molecular formula C25H26N2O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is (3S,4R)-4-[4-(4-deuteriopiperazin-1-yl)phenyl]-3-phenyl-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | (3S,4R)-4-[4-(4-deuteriopiperazin-1-yl)phenyl]-3-phenyl-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 175906738 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | (3S,4R)-4-[4-(4-deuteriopiperazin-1-yl)phenyl]-3-phenyl-3,4-dihydro-2H-chromen-7-ol |
| SMILES | [2H]N1CCN(c2ccc([C@@H]3c4ccc(O)cc4OC[C@@H]3c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H26N2O2/c28-21-10-11-22-24(16-21)29-17-23(18-4-2-1-3-5-18)25(22)19-6-8-20(9-7-19)27-14-12-26-13-15-27/h1-11,16,23,25-26,28H,12-15,17H2/t23-,25-/m1/s1/i/hD |
| InChIKey | CNSRZJCVHCISMA-NZIHITPGSA-N |
| XLogP | 4.11 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|