C23H20O4 — CID 163817078
2-[4-[(4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy]acetaldehyde (PubChem CID 163817078) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[4-[(4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy]acetaldehyde.
| Compound Name | 2-[4-[(4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 163817078 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-[4-[(4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy]acetaldehyde |
| SMILES | O=CCOc1ccc([C@@H]2c3ccc(O)cc3OCC2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20O4/c24-12-13-26-19-9-6-17(7-10-19)23-20-11-8-18(25)14-22(20)27-15-21(23)16-4-2-1-3-5-16/h1-12,14,21,23,25H,13,15H2/t21?,23-/m1/s1 |
| InChIKey | NSGPINIVYUJQFC-JFGZAKSSSA-N |
| XLogP | 4.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|