C19H17NO6S3 — CID 25213773
5-(4-methoxy-3-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)dithiole-3-thione (PubChem CID 25213773) has the molecular formula C19H17NO6S3 and a molecular weight of 451.55 g/mol. Its IUPAC name is 5-(4-methoxy-3-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)dithiole-3-thione.
| Compound Name | 5-(4-methoxy-3-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)dithiole-3-thione |
|---|---|
| PubChem CID | 25213773 |
| Molecular Formula | C19H17NO6S3 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 5-(4-methoxy-3-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)dithiole-3-thione |
| SMILES | COc1ccc(-c2ssc(=S)c2-c2cc(OC)c(OC)c(OC)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17NO6S3/c1-23-13-6-5-10(7-12(13)20(21)22)18-16(19(27)29-28-18)11-8-14(24-2)17(26-4)15(9-11)25-3/h5-9H,1-4H3 |
| InChIKey | DEFLDOBMPDHJKH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|