C25H26N2O9 — CID 56945197
3,4,5-trimethoxy-N-[2-nitro-4-(3,4,5-trimethoxyphenyl)phenyl]benzamide (PubChem CID 56945197) has the molecular formula C25H26N2O9 and a molecular weight of 498.49 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-nitro-4-(3,4,5-trimethoxyphenyl)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-nitro-4-(3,4,5-trimethoxyphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 56945197 |
| Molecular Formula | C25H26N2O9 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-nitro-4-(3,4,5-trimethoxyphenyl)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(-c3cc(OC)c(OC)c(OC)c3)cc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C25H26N2O9/c1-31-19-10-15(11-20(32-2)23(19)35-5)14-7-8-17(18(9-14)27(29)30)26-25(28)16-12-21(33-3)24(36-6)22(13-16)34-4/h7-13H,1-6H3,(H,26,28) |
| InChIKey | OYOLDSYSIDZOFA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|