C16H16N2O5 — CID 5110983
3,4-dimethoxy-N-(4-methyl-2-nitrophenyl)benzamide (PubChem CID 5110983) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(4-methyl-2-nitrophenyl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(4-methyl-2-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 5110983 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3,4-dimethoxy-N-(4-methyl-2-nitrophenyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H16N2O5/c1-10-4-6-12(13(8-10)18(20)21)17-16(19)11-5-7-14(22-2)15(9-11)23-3/h4-9H,1-3H3,(H,17,19) |
| InChIKey | DMLSXYAORPRJBV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|