C16H18N2O3 — CID 28866924
N-(2-amino-4-methylphenyl)-3,4-dimethoxybenzamide (PubChem CID 28866924) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(2-amino-4-methylphenyl)-3,4-dimethoxybenzamide.
| Compound Name | N-(2-amino-4-methylphenyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 28866924 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-(2-amino-4-methylphenyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C)cc2N)cc1OC |
| InChI | InChI=1S/C16H18N2O3/c1-10-4-6-13(12(17)8-10)18-16(19)11-5-7-14(20-2)15(9-11)21-3/h4-9H,17H2,1-3H3,(H,18,19) |
| InChIKey | AAYOSNVUORDIGO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|