C22H24O8 — CID 142929764
2-(4,5-dimethoxy-2-methylphenyl)-5,6,7,8-tetramethoxychromen-4-one (PubChem CID 142929764) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylphenyl)-5,6,7,8-tetramethoxychromen-4-one.
| Compound Name | 2-(4,5-dimethoxy-2-methylphenyl)-5,6,7,8-tetramethoxychromen-4-one |
|---|---|
| PubChem CID | 142929764 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylphenyl)-5,6,7,8-tetramethoxychromen-4-one |
| SMILES | COc1cc(C)c(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1OC |
| InChI | InChI=1S/C22H24O8/c1-11-8-15(24-2)16(25-3)9-12(11)14-10-13(23)17-18(26-4)20(27-5)22(29-7)21(28-6)19(17)30-14/h8-10H,1-7H3 |
| InChIKey | ZKSCLIHRKNLYFP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |