C22H25NO11S — CID 141103630
4,5-dimethoxy-2-(3,5,6,7,8-pentamethoxy-4-oxochromen-2-yl)benzenesulfonamide (PubChem CID 141103630) has the molecular formula C22H25NO11S and a molecular weight of 511.51 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(3,5,6,7,8-pentamethoxy-4-oxochromen-2-yl)benzenesulfonamide.
| Compound Name | 4,5-dimethoxy-2-(3,5,6,7,8-pentamethoxy-4-oxochromen-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 141103630 |
| Molecular Formula | C22H25NO11S |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 4,5-dimethoxy-2-(3,5,6,7,8-pentamethoxy-4-oxochromen-2-yl)benzenesulfonamide |
| SMILES | COc1cc(-c2oc3c(OC)c(OC)c(OC)c(OC)c3c(=O)c2OC)c(S(N)(=O)=O)cc1OC |
| InChI | InChI=1S/C22H25NO11S/c1-27-11-8-10(13(35(23,25)26)9-12(11)28-2)16-19(30-4)15(24)14-17(29-3)20(31-5)22(33-7)21(32-6)18(14)34-16/h8-9H,1-7H3,(H2,23,25,26) |
| InChIKey | OLSKAFBEPWHFPD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 154.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |